C17H13Cl2N3O4 — CID 113082149
2-(2,4-dichlorophenoxy)-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]acetamide (PubChem CID 113082149) has the molecular formula C17H13Cl2N3O4 and a molecular weight of 394.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 113082149 |
| Molecular Formula | C17H13Cl2N3O4 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCCN1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C17H13Cl2N3O4/c18-10-3-4-13(12(19)8-10)26-9-14(23)20-6-7-22-16(24)11-2-1-5-21-15(11)17(22)25/h1-5,8H,6-7,9H2,(H,20,23) |
| InChIKey | JEUPQKYEHSFRNN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|