C21H19ClN2O4 — CID 113082526
2-[1-[2-(4-chlorophenoxy)acetyl]piperidin-4-yl]isoindole-1,3-dione (PubChem CID 113082526) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is 2-[1-[2-(4-chlorophenoxy)acetyl]piperidin-4-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[2-(4-chlorophenoxy)acetyl]piperidin-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 113082526 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[1-[2-(4-chlorophenoxy)acetyl]piperidin-4-yl]isoindole-1,3-dione |
| SMILES | O=C(COc1ccc(Cl)cc1)N1CCC(N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C21H19ClN2O4/c22-14-5-7-16(8-6-14)28-13-19(25)23-11-9-15(10-12-23)24-20(26)17-3-1-2-4-18(17)21(24)27/h1-8,15H,9-13H2 |
| InChIKey | JBTFHGIHNPUODE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|