C21H21N3O4 — CID 113082613
6-[1-[2-(4-methylphenoxy)acetyl]piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 113082613) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 6-[1-[2-(4-methylphenoxy)acetyl]piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[1-[2-(4-methylphenoxy)acetyl]piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 113082613 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 6-[1-[2-(4-methylphenoxy)acetyl]piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | Cc1ccc(OCC(=O)N2CCC(N3C(=O)c4cccnc4C3=O)CC2)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-14-4-6-16(7-5-14)28-13-18(25)23-11-8-15(9-12-23)24-20(26)17-3-2-10-22-19(17)21(24)27/h2-7,10,15H,8-9,11-13H2,1H3 |
| InChIKey | ZAXGFVNZIOCXBE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|