C24H30N2O3 — CID 56551157
2-[4-(4-methylphenoxy)phenoxy]-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone (PubChem CID 56551157) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[4-(4-methylphenoxy)phenoxy]-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone.
| Compound Name | 2-[4-(4-methylphenoxy)phenoxy]-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 56551157 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-[4-(4-methylphenoxy)phenoxy]-1-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanone |
| SMILES | Cc1ccc(Oc2ccc(OCC(=O)N3CCC(N4CCCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O3/c1-19-4-6-22(7-5-19)29-23-10-8-21(9-11-23)28-18-24(27)26-16-12-20(13-17-26)25-14-2-3-15-25/h4-11,20H,2-3,12-18H2,1H3 |
| InChIKey | GDBRBRLUKYWCKS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |