C23H34N2O6 — CID 2910783
1-[4-(3,5-dimethylpiperidin-1-yl)piperidin-1-yl]-2-(4-methylphenoxy)ethanone;oxalic acid (PubChem CID 2910783) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)piperidin-1-yl]-2-(4-methylphenoxy)ethanone;oxalic acid.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)piperidin-1-yl]-2-(4-methylphenoxy)ethanone;oxalic acid |
|---|---|
| PubChem CID | 2910783 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)piperidin-1-yl]-2-(4-methylphenoxy)ethanone;oxalic acid |
| SMILES | Cc1ccc(OCC(=O)N2CCC(N3CC(C)CC(C)C3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H32N2O2.C2H2O4/c1-16-4-6-20(7-5-16)25-15-21(24)22-10-8-19(9-11-22)23-13-17(2)12-18(3)14-23;3-1(4)2(5)6/h4-7,17-19H,8-15H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | IXAWUWLCLYHAHV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|