C21H21N3O3 — CID 113082603
6-[1-(3-phenylpropanoyl)piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 113082603) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 6-[1-(3-phenylpropanoyl)piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[1-(3-phenylpropanoyl)piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 113082603 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 6-[1-(3-phenylpropanoyl)piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C(CCc1ccccc1)N1CCC(N2C(=O)c3cccnc3C2=O)CC1 |
| InChI | InChI=1S/C21H21N3O3/c25-18(9-8-15-5-2-1-3-6-15)23-13-10-16(11-14-23)24-20(26)17-7-4-12-22-19(17)21(24)27/h1-7,12,16H,8-11,13-14H2 |
| InChIKey | AWYOLMDLMDHVQO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|