C19H16ClN3O3 — CID 113082608
6-[1-(3-chlorobenzoyl)piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 113082608) has the molecular formula C19H16ClN3O3 and a molecular weight of 369.81 g/mol. Its IUPAC name is 6-[1-(3-chlorobenzoyl)piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[1-(3-chlorobenzoyl)piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 113082608 |
| Molecular Formula | C19H16ClN3O3 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 6-[1-(3-chlorobenzoyl)piperidin-4-yl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C(c1cccc(Cl)c1)N1CCC(N2C(=O)c3cccnc3C2=O)CC1 |
| InChI | InChI=1S/C19H16ClN3O3/c20-13-4-1-3-12(11-13)17(24)22-9-6-14(7-10-22)23-18(25)15-5-2-8-21-16(15)19(23)26/h1-5,8,11,14H,6-7,9-10H2 |
| InChIKey | ZCFKUZUHFPUBNU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|