C18H16N4O3 — CID 113082706
3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-phenylpyrrolidine-1-carboxamide (PubChem CID 113082706) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-phenylpyrrolidine-1-carboxamide.
| Compound Name | 3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 113082706 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-phenylpyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCC(N2C(=O)c3cccnc3C2=O)C1 |
| InChI | InChI=1S/C18H16N4O3/c23-16-14-7-4-9-19-15(14)17(24)22(16)13-8-10-21(11-13)18(25)20-12-5-2-1-3-6-12/h1-7,9,13H,8,10-11H2,(H,20,25) |
| InChIKey | GPDROMHRZCHSPZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|