C21H21FN2O4 — CID 113083201
2-[[1-[2-(2-fluorophenyl)acetyl]piperidin-4-yl]carbamoyl]benzoic acid (PubChem CID 113083201) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-[[1-[2-(2-fluorophenyl)acetyl]piperidin-4-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[[1-[2-(2-fluorophenyl)acetyl]piperidin-4-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 113083201 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[[1-[2-(2-fluorophenyl)acetyl]piperidin-4-yl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)NC1CCN(C(=O)Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C21H21FN2O4/c22-18-8-4-1-5-14(18)13-19(25)24-11-9-15(10-12-24)23-20(26)16-6-2-3-7-17(16)21(27)28/h1-8,15H,9-13H2,(H,23,26)(H,27,28) |
| InChIKey | KASZMHIIECLFLS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |