C23H26N2O4 — CID 113084931
3,4,5-trimethoxy-N-[[1-(1-methylindol-3-yl)cyclopropyl]methyl]benzamide (PubChem CID 113084931) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[1-(1-methylindol-3-yl)cyclopropyl]methyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[1-(1-methylindol-3-yl)cyclopropyl]methyl]benzamide |
|---|---|
| PubChem CID | 113084931 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[1-(1-methylindol-3-yl)cyclopropyl]methyl]benzamide |
| SMILES | COc1cc(C(=O)NCC2(c3cn(C)c4ccccc34)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H26N2O4/c1-25-13-17(16-7-5-6-8-18(16)25)23(9-10-23)14-24-22(26)15-11-19(27-2)21(29-4)20(12-15)28-3/h5-8,11-13H,9-10,14H2,1-4H3,(H,24,26) |
| InChIKey | FPBLGULZSMMOHQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |