C21H24N2O3S — CID 113085851
2-methoxy-5-methyl-N-[[1-(2-methyl-1H-indol-3-yl)cyclopropyl]methyl]benzenesulfonamide (PubChem CID 113085851) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-methoxy-5-methyl-N-[[1-(2-methyl-1H-indol-3-yl)cyclopropyl]methyl]benzenesulfonamide.
| Compound Name | 2-methoxy-5-methyl-N-[[1-(2-methyl-1H-indol-3-yl)cyclopropyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113085851 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-methoxy-5-methyl-N-[[1-(2-methyl-1H-indol-3-yl)cyclopropyl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)NCC1(c2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C21H24N2O3S/c1-14-8-9-18(26-3)19(12-14)27(24,25)22-13-21(10-11-21)20-15(2)23-17-7-5-4-6-16(17)20/h4-9,12,22-23H,10-11,13H2,1-3H3 |
| InChIKey | COOMBYLERDAINN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |