C20H22N2O2S — CID 113089044
2-[1-(2-methylphenyl)sulfonylpiperidin-2-yl]-1H-indole (PubChem CID 113089044) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-[1-(2-methylphenyl)sulfonylpiperidin-2-yl]-1H-indole.
| Compound Name | 2-[1-(2-methylphenyl)sulfonylpiperidin-2-yl]-1H-indole |
|---|---|
| PubChem CID | 113089044 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-[1-(2-methylphenyl)sulfonylpiperidin-2-yl]-1H-indole |
| SMILES | Cc1ccccc1S(=O)(=O)N1CCCCC1c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H22N2O2S/c1-15-8-2-5-12-20(15)25(23,24)22-13-7-6-11-19(22)18-14-16-9-3-4-10-17(16)21-18/h2-5,8-10,12,14,19,21H,6-7,11,13H2,1H3 |
| InChIKey | DHUOTUDBYMRHHO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |