C19H23N3 — CID 122668604
2-[1-[1-(1H-pyrrol-2-yl)ethyl]piperidin-2-yl]-1H-indole (PubChem CID 122668604) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-[1-[1-(1H-pyrrol-2-yl)ethyl]piperidin-2-yl]-1H-indole.
| Compound Name | 2-[1-[1-(1H-pyrrol-2-yl)ethyl]piperidin-2-yl]-1H-indole |
|---|---|
| PubChem CID | 122668604 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2-[1-[1-(1H-pyrrol-2-yl)ethyl]piperidin-2-yl]-1H-indole |
| SMILES | CC(c1ccc[nH]1)N1CCCCC1c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H23N3/c1-14(16-9-6-11-20-16)22-12-5-4-10-19(22)18-13-15-7-2-3-8-17(15)21-18/h2-3,6-9,11,13-14,19-21H,4-5,10,12H2,1H3 |
| InChIKey | BVNHTWBCNNRNDK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |