C20H19ClN2O2 — CID 113089964
2-(4-chlorophenoxy)-1-(9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)ethanone (PubChem CID 113089964) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-(9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)ethanone.
| Compound Name | 2-(4-chlorophenoxy)-1-(9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 113089964 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-(9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl)ethanone |
| SMILES | Cn1c2c(c3ccccc31)CCN(C(=O)COc1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C20H19ClN2O2/c1-22-18-5-3-2-4-16(18)17-10-11-23(12-19(17)22)20(24)13-25-15-8-6-14(21)7-9-15/h2-9H,10-13H2,1H3 |
| InChIKey | GPGCBQMOIHPTFG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|