C19H25N3O — CID 113089986
N-cyclohexyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide (PubChem CID 113089986) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-cyclohexyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-cyclohexyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 113089986 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-cyclohexyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxamide |
| SMILES | Cn1c2c(c3ccccc31)CCN(C(=O)NC1CCCCC1)C2 |
| InChI | InChI=1S/C19H25N3O/c1-21-17-10-6-5-9-15(17)16-11-12-22(13-18(16)21)19(23)20-14-7-3-2-4-8-14/h5-6,9-10,14H,2-4,7-8,11-13H2,1H3,(H,20,23) |
| InChIKey | IYDYPTPHMMKVKD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|