C18H19FN2O2 — CID 113092818
N-[2-[acetyl(methyl)amino]-5-fluorophenyl]-3,4-dimethylbenzamide (PubChem CID 113092818) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is N-[2-[acetyl(methyl)amino]-5-fluorophenyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-[acetyl(methyl)amino]-5-fluorophenyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 113092818 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[2-[acetyl(methyl)amino]-5-fluorophenyl]-3,4-dimethylbenzamide |
| SMILES | CC(=O)N(C)c1ccc(F)cc1NC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H19FN2O2/c1-11-5-6-14(9-12(11)2)18(23)20-16-10-15(19)7-8-17(16)21(4)13(3)22/h5-10H,1-4H3,(H,20,23) |
| InChIKey | WRNFCRYYDOIHCK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |