C17H19FN2O5S — CID 17459398
N-(5-fluoro-2-methylphenyl)-4-methoxy-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 17459398) has the molecular formula C17H19FN2O5S and a molecular weight of 382.41 g/mol. Its IUPAC name is N-(5-fluoro-2-methylphenyl)-4-methoxy-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | N-(5-fluoro-2-methylphenyl)-4-methoxy-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 17459398 |
| Molecular Formula | C17H19FN2O5S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-(5-fluoro-2-methylphenyl)-4-methoxy-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(F)ccc2C)cc1S(=O)(=O)N(C)OC |
| InChI | InChI=1S/C17H19FN2O5S/c1-11-5-7-13(18)10-14(11)19-17(21)12-6-8-15(24-3)16(9-12)26(22,23)20(2)25-4/h5-10H,1-4H3,(H,19,21) |
| InChIKey | FMWDYFJIDQOYRI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|