C20H20F2N2O3 — CID 113094199
N-[4-[acetyl(oxan-4-yl)amino]phenyl]-3,4-difluorobenzamide (PubChem CID 113094199) has the molecular formula C20H20F2N2O3 and a molecular weight of 374.39 g/mol. Its IUPAC name is N-[4-[acetyl(oxan-4-yl)amino]phenyl]-3,4-difluorobenzamide.
| Compound Name | N-[4-[acetyl(oxan-4-yl)amino]phenyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113094199 |
| Molecular Formula | C20H20F2N2O3 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[4-[acetyl(oxan-4-yl)amino]phenyl]-3,4-difluorobenzamide |
| SMILES | CC(=O)N(c1ccc(NC(=O)c2ccc(F)c(F)c2)cc1)C1CCOCC1 |
| InChI | InChI=1S/C20H20F2N2O3/c1-13(25)24(17-8-10-27-11-9-17)16-5-3-15(4-6-16)23-20(26)14-2-7-18(21)19(22)12-14/h2-7,12,17H,8-11H2,1H3,(H,23,26) |
| InChIKey | ATRDCORFYCWICN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |