C23H31NO4 — CID 113095739
4-tert-butyl-N-methyl-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide (PubChem CID 113095739) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 4-tert-butyl-N-methyl-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-methyl-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 113095739 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 4-tert-butyl-N-methyl-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1cc(CCN(C)C(=O)c2ccc(C(C)(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H31NO4/c1-23(2,3)18-10-8-17(9-11-18)22(25)24(4)13-12-16-14-19(26-5)21(28-7)20(15-16)27-6/h8-11,14-15H,12-13H2,1-7H3 |
| InChIKey | HAYARGVSACWTMO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |