C18H23N3O3 — CID 113097993
N-[2-(4-cyclopropylpiperazin-1-yl)-2-oxoethyl]-2-oxo-3-phenylpropanamide (PubChem CID 113097993) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[2-(4-cyclopropylpiperazin-1-yl)-2-oxoethyl]-2-oxo-3-phenylpropanamide.
| Compound Name | N-[2-(4-cyclopropylpiperazin-1-yl)-2-oxoethyl]-2-oxo-3-phenylpropanamide |
|---|---|
| PubChem CID | 113097993 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[2-(4-cyclopropylpiperazin-1-yl)-2-oxoethyl]-2-oxo-3-phenylpropanamide |
| SMILES | O=C(Cc1ccccc1)C(=O)NCC(=O)N1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C18H23N3O3/c22-16(12-14-4-2-1-3-5-14)18(24)19-13-17(23)21-10-8-20(9-11-21)15-6-7-15/h1-5,15H,6-13H2,(H,19,24) |
| InChIKey | WVTPRSRTZQAIBU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|