C7H11NO5 — CID 11309993
(1S,2R,6S,7R,8S)-1,2,6,7-tetrahydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 11309993) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S)-1,2,6,7-tetrahydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1S,2R,6S,7R,8S)-1,2,6,7-tetrahydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 11309993 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (1S,2R,6S,7R,8S)-1,2,6,7-tetrahydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | O=C1[C@H](O)[C@@H](O)[C@@H]2[C@@H](O)[C@@H](O)CN12 |
| InChI | InChI=1S/C7H11NO5/c9-2-1-8-3(4(2)10)5(11)6(12)7(8)13/h2-6,9-12H,1H2/t2-,3-,4-,5-,6+/m0/s1 |
| InChIKey | WFBKFEXOYZSTRG-GKFJPSPNSA-N |
| XLogP | -3.35 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |