C15H20BrN3O — CID 113103702
4-(3-bromo-4-methylphenyl)-N-prop-2-enylpiperazine-1-carboxamide (PubChem CID 113103702) has the molecular formula C15H20BrN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is 4-(3-bromo-4-methylphenyl)-N-prop-2-enylpiperazine-1-carboxamide.
| Compound Name | 4-(3-bromo-4-methylphenyl)-N-prop-2-enylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 113103702 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-(3-bromo-4-methylphenyl)-N-prop-2-enylpiperazine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCN(c2ccc(C)c(Br)c2)CC1 |
| InChI | InChI=1S/C15H20BrN3O/c1-3-6-17-15(20)19-9-7-18(8-10-19)13-5-4-12(2)14(16)11-13/h3-5,11H,1,6-10H2,2H3,(H,17,20) |
| InChIKey | BWUZQQYWNQWITQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|