C17H25N3O4 — CID 113105249
methyl 3-[[4-(3-methoxypropyl)piperazine-1-carbonyl]amino]benzoate (PubChem CID 113105249) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is methyl 3-[[4-(3-methoxypropyl)piperazine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[4-(3-methoxypropyl)piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 113105249 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | methyl 3-[[4-(3-methoxypropyl)piperazine-1-carbonyl]amino]benzoate |
| SMILES | COCCCN1CCN(C(=O)Nc2cccc(C(=O)OC)c2)CC1 |
| InChI | InChI=1S/C17H25N3O4/c1-23-12-4-7-19-8-10-20(11-9-19)17(22)18-15-6-3-5-14(13-15)16(21)24-2/h3,5-6,13H,4,7-12H2,1-2H3,(H,18,22) |
| InChIKey | MMFXDWCLSDGUJJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|