C18H29N3O2 — CID 59413874
N-(3-methoxyphenyl)-4-(4-methylpentyl)piperazine-1-carboxamide (PubChem CID 59413874) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-(4-methylpentyl)piperazine-1-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-4-(4-methylpentyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 59413874 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | N-(3-methoxyphenyl)-4-(4-methylpentyl)piperazine-1-carboxamide |
| SMILES | COc1cccc(NC(=O)N2CCN(CCCC(C)C)CC2)c1 |
| InChI | InChI=1S/C18H29N3O2/c1-15(2)6-5-9-20-10-12-21(13-11-20)18(22)19-16-7-4-8-17(14-16)23-3/h4,7-8,14-15H,5-6,9-13H2,1-3H3,(H,19,22) |
| InChIKey | HSSFVDTUPKSEKQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |