C17H24ClN3O3 — CID 113105580
4-(3-chloro-4-methoxyphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carboxamide (PubChem CID 113105580) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxyphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carboxamide.
| Compound Name | 4-(3-chloro-4-methoxyphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113105580 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 4-(3-chloro-4-methoxyphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)NCC3CCCO3)CC2)cc1Cl |
| InChI | InChI=1S/C17H24ClN3O3/c1-23-16-5-4-13(11-15(16)18)20-6-8-21(9-7-20)17(22)19-12-14-3-2-10-24-14/h4-5,11,14H,2-3,6-10,12H2,1H3,(H,19,22) |
| InChIKey | HUJMYSDUPFNGSL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|