C17H25FN4O3 — CID 167957043
4-(4-fluoro-3-methoxyphenyl)-N-(morpholin-2-ylmethyl)piperazine-1-carboxamide (PubChem CID 167957043) has the molecular formula C17H25FN4O3 and a molecular weight of 352.41 g/mol. Its IUPAC name is 4-(4-fluoro-3-methoxyphenyl)-N-(morpholin-2-ylmethyl)piperazine-1-carboxamide.
| Compound Name | 4-(4-fluoro-3-methoxyphenyl)-N-(morpholin-2-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 167957043 |
| Molecular Formula | C17H25FN4O3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 4-(4-fluoro-3-methoxyphenyl)-N-(morpholin-2-ylmethyl)piperazine-1-carboxamide |
| SMILES | COc1cc(N2CCN(C(=O)NCC3CNCCO3)CC2)ccc1F |
| InChI | InChI=1S/C17H25FN4O3/c1-24-16-10-13(2-3-15(16)18)21-5-7-22(8-6-21)17(23)20-12-14-11-19-4-9-25-14/h2-3,10,14,19H,4-9,11-12H2,1H3,(H,20,23) |
| InChIKey | LRWDDXPXXYVOER-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |