C16H24FN3O2S — CID 100750755
4-(4-fluoro-3-methoxyphenyl)-N-[(2S)-2-methylsulfanylpropyl]piperazine-1-carboxamide (PubChem CID 100750755) has the molecular formula C16H24FN3O2S and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-(4-fluoro-3-methoxyphenyl)-N-[(2S)-2-methylsulfanylpropyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-fluoro-3-methoxyphenyl)-N-[(2S)-2-methylsulfanylpropyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 100750755 |
| Molecular Formula | C16H24FN3O2S |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-(4-fluoro-3-methoxyphenyl)-N-[(2S)-2-methylsulfanylpropyl]piperazine-1-carboxamide |
| SMILES | COc1cc(N2CCN(C(=O)NC[C@H](C)SC)CC2)ccc1F |
| InChI | InChI=1S/C16H24FN3O2S/c1-12(23-3)11-18-16(21)20-8-6-19(7-9-20)13-4-5-14(17)15(10-13)22-2/h4-5,10,12H,6-9,11H2,1-3H3,(H,18,21)/t12-/m0/s1 |
| InChIKey | LINWMYKYPZFNMW-LBPRGKRZSA-N |
| XLogP | 2.42 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |