C14H15FN4O2S — CID 146122341
[4-(4-fluoro-3-methoxyphenyl)piperazin-1-yl]-(thiadiazol-5-yl)methanone (PubChem CID 146122341) has the molecular formula C14H15FN4O2S and a molecular weight of 322.37 g/mol. Its IUPAC name is [4-(4-fluoro-3-methoxyphenyl)piperazin-1-yl]-(thiadiazol-5-yl)methanone.
| Compound Name | [4-(4-fluoro-3-methoxyphenyl)piperazin-1-yl]-(thiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 146122341 |
| Molecular Formula | C14H15FN4O2S |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [4-(4-fluoro-3-methoxyphenyl)piperazin-1-yl]-(thiadiazol-5-yl)methanone |
| SMILES | COc1cc(N2CCN(C(=O)c3cnns3)CC2)ccc1F |
| InChI | InChI=1S/C14H15FN4O2S/c1-21-12-8-10(2-3-11(12)15)18-4-6-19(7-5-18)14(20)13-9-16-17-22-13/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | DMAUHFMWNGNSQO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |