C19H19F3N2O3 — CID 110363823
[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 110363823) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is [4-(3,4-dimethoxyphenyl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-(3,4-dimethoxyphenyl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 110363823 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [4-(3,4-dimethoxyphenyl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc(F)c(F)c3F)CC2)cc1OC |
| InChI | InChI=1S/C19H19F3N2O3/c1-26-15-6-3-12(11-16(15)27-2)23-7-9-24(10-8-23)19(25)13-4-5-14(20)18(22)17(13)21/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | JBPHFXGCVOSRJV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|