About 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone
1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone (PubChem CID 97143351) has the molecular formula C16H21Cl2N3O2
and a molecular weight of 358.27 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone |
| PubChem CID | 97143351 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone |
| SMILES | O=C(C[C@H]1CNCCO1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H21Cl2N3O2/c17-14-2-1-12(9-15(14)18)20-4-6-21(7-5-20)16(22)10-13-11-19-3-8-23-13/h1-2,9,13,19H,3-8,10-11H2/t13-/m0/s1 |
| InChIKey | MGKOJUATLAUZFH-ZDUSSCGKSA-N |
| XLogP | 2.02 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone?
The IUPAC name of 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone (CID 97143351) is 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone.
What is the SMILES notation for 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone?
The canonical SMILES for 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone is O=C(C[C@H]1CNCCO1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1.
What is the InChIKey of 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone?
The InChIKey is MGKOJUATLAUZFH-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H21Cl2N3O2/c17-14-2-1-12(9-15(14)18)20-4-6-21(7-5-20)16(22)10-13-11-19-3-8-23-13/h1-2,9,13,19H,3-8,10-11H2/t13-/m0/s1.
What are the key properties of 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone?
1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone has a molecular weight of 358.27 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2-[(2S)-morpholin-2-yl]ethanone is sourced from PubChem (CID 97143351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).