C15H22ClN3O2S — CID 119832752
1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-morpholin-2-ylethanone (PubChem CID 119832752) has the molecular formula C15H22ClN3O2S and a molecular weight of 343.88 g/mol. Its IUPAC name is 1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-morpholin-2-ylethanone.
| Compound Name | 1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-morpholin-2-ylethanone |
|---|---|
| PubChem CID | 119832752 |
| Molecular Formula | C15H22ClN3O2S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-morpholin-2-ylethanone |
| SMILES | O=C(CC1CNCCO1)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C15H22ClN3O2S/c16-14-2-1-13(22-14)11-18-4-6-19(7-5-18)15(20)9-12-10-17-3-8-21-12/h1-2,12,17H,3-11H2 |
| InChIKey | MLUSRLMYEQTDJM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |