C13H17NOS — CID 11310897
(NE,S)-2-methyl-N-[(E)-3-phenylprop-2-enylidene]propane-2-sulfinamide (PubChem CID 11310897) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is (NE,S)-2-methyl-N-[(E)-3-phenylprop-2-enylidene]propane-2-sulfinamide.
| Compound Name | (NE,S)-2-methyl-N-[(E)-3-phenylprop-2-enylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 11310897 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (NE,S)-2-methyl-N-[(E)-3-phenylprop-2-enylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)/N=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H17NOS/c1-13(2,3)16(15)14-11-7-10-12-8-5-4-6-9-12/h4-11H,1-3H3/b10-7+,14-11+/t16-/m0/s1 |
| InChIKey | GAJYCTBPVPIASS-UTHPALBASA-N |
| XLogP | 3.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|