C20H22N4O — CID 113111543
N-(2-cyanophenyl)-4-(2,5-dimethylphenyl)piperazine-1-carboxamide (PubChem CID 113111543) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is N-(2-cyanophenyl)-4-(2,5-dimethylphenyl)piperazine-1-carboxamide.
| Compound Name | N-(2-cyanophenyl)-4-(2,5-dimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113111543 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-(2-cyanophenyl)-4-(2,5-dimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)Nc3ccccc3C#N)CC2)c1 |
| InChI | InChI=1S/C20H22N4O/c1-15-7-8-16(2)19(13-15)23-9-11-24(12-10-23)20(25)22-18-6-4-3-5-17(18)14-21/h3-8,13H,9-12H2,1-2H3,(H,22,25) |
| InChIKey | CWAYCEANFZEZNY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |