C23H29N3O3 — CID 113112479
ethyl 2-[4-[(2,4,6-trimethylphenyl)carbamoyl]piperazin-1-yl]benzoate (PubChem CID 113112479) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is ethyl 2-[4-[(2,4,6-trimethylphenyl)carbamoyl]piperazin-1-yl]benzoate.
| Compound Name | ethyl 2-[4-[(2,4,6-trimethylphenyl)carbamoyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 113112479 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | ethyl 2-[4-[(2,4,6-trimethylphenyl)carbamoyl]piperazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1N1CCN(C(=O)Nc2c(C)cc(C)cc2C)CC1 |
| InChI | InChI=1S/C23H29N3O3/c1-5-29-22(27)19-8-6-7-9-20(19)25-10-12-26(13-11-25)23(28)24-21-17(3)14-16(2)15-18(21)4/h6-9,14-15H,5,10-13H2,1-4H3,(H,24,28) |
| InChIKey | PCKYNIANWBXMQH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |