C12H24O4Si — CID 11311521
ethyl (2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carboxylate (PubChem CID 11311521) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 11311521 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | ethyl (2S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxirane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O4Si/c1-7-14-11(13)10-9(16-10)8-15-17(5,6)12(2,3)4/h9-10H,7-8H2,1-6H3/t9-,10+/m1/s1 |
| InChIKey | BDQYKUBKNPKEDD-ZJUUUORDSA-N |
| XLogP | 2.34 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|