C13H26N2O3 — CID 113117131
3-[acetyl(3-methoxypropyl)amino]-N,N-diethylpropanamide (PubChem CID 113117131) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-[acetyl(3-methoxypropyl)amino]-N,N-diethylpropanamide.
| Compound Name | 3-[acetyl(3-methoxypropyl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 113117131 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 3-[acetyl(3-methoxypropyl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCN(CCCOC)C(C)=O |
| InChI | InChI=1S/C13H26N2O3/c1-5-14(6-2)13(17)8-10-15(12(3)16)9-7-11-18-4/h5-11H2,1-4H3 |
| InChIKey | KVUYHSRJAFPBPR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|