C17H28N4O2 — CID 113117493
3-[acetyl-[2-(dimethylamino)ethyl]amino]-N-methyl-N-(2-pyridin-4-ylethyl)propanamide (PubChem CID 113117493) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-[acetyl-[2-(dimethylamino)ethyl]amino]-N-methyl-N-(2-pyridin-4-ylethyl)propanamide.
| Compound Name | 3-[acetyl-[2-(dimethylamino)ethyl]amino]-N-methyl-N-(2-pyridin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 113117493 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-[acetyl-[2-(dimethylamino)ethyl]amino]-N-methyl-N-(2-pyridin-4-ylethyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)N(C)CCc1ccncc1)CCN(C)C |
| InChI | InChI=1S/C17H28N4O2/c1-15(22)21(14-13-19(2)3)12-8-17(23)20(4)11-7-16-5-9-18-10-6-16/h5-6,9-10H,7-8,11-14H2,1-4H3 |
| InChIKey | ZAYDMXJGJJAUET-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |