C18H26ClN3O4 — CID 113117750
3-[acetyl(2-morpholin-4-ylethyl)amino]-N-(3-chloro-4-methoxyphenyl)propanamide (PubChem CID 113117750) has the molecular formula C18H26ClN3O4 and a molecular weight of 383.88 g/mol. Its IUPAC name is 3-[acetyl(2-morpholin-4-ylethyl)amino]-N-(3-chloro-4-methoxyphenyl)propanamide.
| Compound Name | 3-[acetyl(2-morpholin-4-ylethyl)amino]-N-(3-chloro-4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 113117750 |
| Molecular Formula | C18H26ClN3O4 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-[acetyl(2-morpholin-4-ylethyl)amino]-N-(3-chloro-4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCN(CCN2CCOCC2)C(C)=O)cc1Cl |
| InChI | InChI=1S/C18H26ClN3O4/c1-14(23)22(8-7-21-9-11-26-12-10-21)6-5-18(24)20-15-3-4-17(25-2)16(19)13-15/h3-4,13H,5-12H2,1-2H3,(H,20,24) |
| InChIKey | JBRXYHXRBBBCLU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |