C16H19NO3 — CID 11311841
ethyl 1-ethyl-7-methoxy-3H-2-benzazepine-4-carboxylate (PubChem CID 11311841) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is ethyl 1-ethyl-7-methoxy-3H-2-benzazepine-4-carboxylate.
| Compound Name | ethyl 1-ethyl-7-methoxy-3H-2-benzazepine-4-carboxylate |
|---|---|
| PubChem CID | 11311841 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | ethyl 1-ethyl-7-methoxy-3H-2-benzazepine-4-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc(OC)ccc2C(CC)=NC1 |
| InChI | InChI=1S/C16H19NO3/c1-4-15-14-7-6-13(19-3)9-11(14)8-12(10-17-15)16(18)20-5-2/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | YQYYWHNPDJBDLU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |