C17H21NO3 — CID 134997320
ethyl 1-methyl-7-propoxy-3H-2-benzazepine-4-carboxylate (PubChem CID 134997320) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 1-methyl-7-propoxy-3H-2-benzazepine-4-carboxylate.
| Compound Name | ethyl 1-methyl-7-propoxy-3H-2-benzazepine-4-carboxylate |
|---|---|
| PubChem CID | 134997320 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | ethyl 1-methyl-7-propoxy-3H-2-benzazepine-4-carboxylate |
| SMILES | CCCOc1ccc2c(c1)C=C(C(=O)OCC)CN=C2C |
| InChI | InChI=1S/C17H21NO3/c1-4-8-21-15-6-7-16-12(3)18-11-14(9-13(16)10-15)17(19)20-5-2/h6-7,9-10H,4-5,8,11H2,1-3H3 |
| InChIKey | OVZBVVODCOHXCN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |