C18H14O2S — CID 11312432
2-methyl-3-phenyl-2,3-dihydrothieno[3,2-c]chromen-4-one (PubChem CID 11312432) has the molecular formula C18H14O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-methyl-3-phenyl-2,3-dihydrothieno[3,2-c]chromen-4-one.
| Compound Name | 2-methyl-3-phenyl-2,3-dihydrothieno[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 11312432 |
| Molecular Formula | C18H14O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-methyl-3-phenyl-2,3-dihydrothieno[3,2-c]chromen-4-one |
| SMILES | CC1Sc2c(c(=O)oc3ccccc23)C1c1ccccc1 |
| InChI | InChI=1S/C18H14O2S/c1-11-15(12-7-3-2-4-8-12)16-17(21-11)13-9-5-6-10-14(13)20-18(16)19/h2-11,15H,1H3 |
| InChIKey | ZLXIAVPLKOLCAT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|