C22H21NO — CID 11313079
N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylmethanimine (PubChem CID 11313079) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylmethanimine.
| Compound Name | N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 11313079 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[(1S,2R)-2-methoxy-1,2-diphenylethyl]-1-phenylmethanimine |
| SMILES | CO[C@H](c1ccccc1)[C@@H](/N=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NO/c1-24-22(20-15-9-4-10-16-20)21(19-13-7-3-8-14-19)23-17-18-11-5-2-6-12-18/h2-17,21-22H,1H3/b23-17+/t21-,22+/m0/s1 |
| InChIKey | OGYPUXOVHMIORT-CPXKFIDQSA-N |
| XLogP | 5.23 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|