C14H20F2N2O4S — CID 113137918
N-(2,6-difluorophenyl)-3-[3-methoxypropyl(methylsulfonyl)amino]propanamide (PubChem CID 113137918) has the molecular formula C14H20F2N2O4S and a molecular weight of 350.39 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-3-[3-methoxypropyl(methylsulfonyl)amino]propanamide.
| Compound Name | N-(2,6-difluorophenyl)-3-[3-methoxypropyl(methylsulfonyl)amino]propanamide |
|---|---|
| PubChem CID | 113137918 |
| Molecular Formula | C14H20F2N2O4S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-3-[3-methoxypropyl(methylsulfonyl)amino]propanamide |
| SMILES | COCCCN(CCC(=O)Nc1c(F)cccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C14H20F2N2O4S/c1-22-10-4-8-18(23(2,20)21)9-7-13(19)17-14-11(15)5-3-6-12(14)16/h3,5-6H,4,7-10H2,1-2H3,(H,17,19) |
| InChIKey | YZCPVRWUKXWDRB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|