C15H22N4O4S — CID 113139886
N-[3-(4-formylpiperazin-1-yl)-3-oxopropyl]-N-(pyridin-3-ylmethyl)methanesulfonamide (PubChem CID 113139886) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is N-[3-(4-formylpiperazin-1-yl)-3-oxopropyl]-N-(pyridin-3-ylmethyl)methanesulfonamide.
| Compound Name | N-[3-(4-formylpiperazin-1-yl)-3-oxopropyl]-N-(pyridin-3-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 113139886 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[3-(4-formylpiperazin-1-yl)-3-oxopropyl]-N-(pyridin-3-ylmethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCC(=O)N1CCN(C=O)CC1)Cc1cccnc1 |
| InChI | InChI=1S/C15H22N4O4S/c1-24(22,23)19(12-14-3-2-5-16-11-14)6-4-15(21)18-9-7-17(13-20)8-10-18/h2-3,5,11,13H,4,6-10,12H2,1H3 |
| InChIKey | NEHHHDSSAIDHEQ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|