C15H19F2N3O4S — CID 113147118
N-(2,6-difluorophenyl)-N-[3-(4-formylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide (PubChem CID 113147118) has the molecular formula C15H19F2N3O4S and a molecular weight of 375.40 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-N-[3-(4-formylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide.
| Compound Name | N-(2,6-difluorophenyl)-N-[3-(4-formylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide |
|---|---|
| PubChem CID | 113147118 |
| Molecular Formula | C15H19F2N3O4S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-N-[3-(4-formylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCC(=O)N1CCN(C=O)CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H19F2N3O4S/c1-25(23,24)20(15-12(16)3-2-4-13(15)17)6-5-14(22)19-9-7-18(11-21)8-10-19/h2-4,11H,5-10H2,1H3 |
| InChIKey | PUTHFLIUGZTTFT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|