C15H20F3N3O3S — CID 113147065
N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-N-(2,3,4-trifluorophenyl)methanesulfonamide (PubChem CID 113147065) has the molecular formula C15H20F3N3O3S and a molecular weight of 379.40 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-N-(2,3,4-trifluorophenyl)methanesulfonamide.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-N-(2,3,4-trifluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 113147065 |
| Molecular Formula | C15H20F3N3O3S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-N-(2,3,4-trifluorophenyl)methanesulfonamide |
| SMILES | CN1CCN(C(=O)CCN(c2ccc(F)c(F)c2F)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H20F3N3O3S/c1-19-7-9-20(10-8-19)13(22)5-6-21(25(2,23)24)12-4-3-11(16)14(17)15(12)18/h3-4H,5-10H2,1-2H3 |
| InChIKey | LITKCGUPOGFBHF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|