C15H18F3N3O2 — CID 113181233
N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 113181233) has the molecular formula C15H18F3N3O2 and a molecular weight of 329.32 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 113181233 |
| Molecular Formula | C15H18F3N3O2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)N1CCN(C)CC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H18F3N3O2/c1-10(22)21(12-4-3-11(16)14(17)15(12)18)9-13(23)20-7-5-19(2)6-8-20/h3-4H,5-9H2,1-2H3 |
| InChIKey | XQIRXTKFRGGFLG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|