C16H22BrN3O2 — CID 113178154
N-(4-bromo-3-methylphenyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]acetamide (PubChem CID 113178154) has the molecular formula C16H22BrN3O2 and a molecular weight of 368.28 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 113178154 |
| Molecular Formula | C16H22BrN3O2 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]acetamide |
| SMILES | CC(=O)N(CC(=O)N1CCN(C)CC1)c1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C16H22BrN3O2/c1-12-10-14(4-5-15(12)17)20(13(2)21)11-16(22)19-8-6-18(3)7-9-19/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | DWFCEVJLZXIAGL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |