C17H23BrN2O2 — CID 113178178
N-(4-bromo-3-methylphenyl)-N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]acetamide (PubChem CID 113178178) has the molecular formula C17H23BrN2O2 and a molecular weight of 367.29 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 113178178 |
| Molecular Formula | C17H23BrN2O2 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]acetamide |
| SMILES | CC(=O)N(CC(=O)N1CCCC(C)C1)c1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C17H23BrN2O2/c1-12-5-4-8-19(10-12)17(22)11-20(14(3)21)15-6-7-16(18)13(2)9-15/h6-7,9,12H,4-5,8,10-11H2,1-3H3 |
| InChIKey | RAFULOFJLNQERB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |