C17H27N3O4S — CID 113144795
N-(2-ethoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide (PubChem CID 113144795) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide.
| Compound Name | N-(2-ethoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide |
|---|---|
| PubChem CID | 113144795 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-(2-ethoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)-3-oxopropyl]methanesulfonamide |
| SMILES | CCOc1ccccc1N(CCC(=O)N1CCN(C)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C17H27N3O4S/c1-4-24-16-8-6-5-7-15(16)20(25(3,22)23)10-9-17(21)19-13-11-18(2)12-14-19/h5-8H,4,9-14H2,1-3H3 |
| InChIKey | SJLWOXASIVINBS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |